C7H17Cl2O5P — CID 172825770
[2-chloro-3-[(2-methylpropan-2-yl)oxy]propyl] dihydrogen phosphate;hydrochloride (PubChem CID 172825770) has the molecular formula C7H17Cl2O5P and a molecular weight of 283.09 g/mol. Its IUPAC name is [2-chloro-3-[(2-methylpropan-2-yl)oxy]propyl] dihydrogen phosphate;hydrochloride.
| Compound Name | [2-chloro-3-[(2-methylpropan-2-yl)oxy]propyl] dihydrogen phosphate;hydrochloride |
|---|---|
| PubChem CID | 172825770 |
| Molecular Formula | C7H17Cl2O5P |
| Molecular Weight | 283.09 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | [2-chloro-3-[(2-methylpropan-2-yl)oxy]propyl] dihydrogen phosphate;hydrochloride |
| SMILES | CC(C)(C)OCC(Cl)COP(=O)(O)O.Cl |
| InChI | InChI=1S/C7H16ClO5P.ClH/c1-7(2,3)12-4-6(8)5-13-14(9,10)11;/h6H,4-5H2,1-3H3,(H2,9,10,11);1H |
| InChIKey | UVMCEUKUSQYVHX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|