C10H22Cl4O9P2 — CID 88760265
1,6-dichloro-3,4-bis(2-chloroethyl)hexane-3,4-diol;phosphono dihydrogen phosphate (PubChem CID 88760265) has the molecular formula C10H22Cl4O9P2 and a molecular weight of 490.04 g/mol. Its IUPAC name is 1,6-dichloro-3,4-bis(2-chloroethyl)hexane-3,4-diol;phosphono dihydrogen phosphate.
| Compound Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hexane-3,4-diol;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 88760265 |
| Molecular Formula | C10H22Cl4O9P2 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 1,6-dichloro-3,4-bis(2-chloroethyl)hexane-3,4-diol;phosphono dihydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)O.OC(CCCl)(CCCl)C(O)(CCCl)CCCl |
| InChI | InChI=1S/C10H18Cl4O2.H4O7P2/c11-5-1-9(15,2-6-12)10(16,3-7-13)4-8-14;1-8(2,3)7-9(4,5)6/h15-16H,1-8H2;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | OKHDFWGXQKQKHY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|