C4H10O4S — CID 88547398
(2R,3R)-4-sulfanyloxybutane-1,2,3-triol (PubChem CID 88547398) has the molecular formula C4H10O4S and a molecular weight of 154.19 g/mol. Its IUPAC name is (2R,3R)-4-sulfanyloxybutane-1,2,3-triol.
| Compound Name | (2R,3R)-4-sulfanyloxybutane-1,2,3-triol |
|---|---|
| PubChem CID | 88547398 |
| Molecular Formula | C4H10O4S |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | (2R,3R)-4-sulfanyloxybutane-1,2,3-triol |
| SMILES | OC[C@@H](O)[C@H](O)COS |
| InChI | InChI=1S/C4H10O4S/c5-1-3(6)4(7)2-8-9/h3-7,9H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | GBCHPIPOIMWAAI-QWWZWVQMSA-N |
| XLogP | -1.44 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|