C5H12O4 — CID 54540788
(2R,3S,4S)-4-deuteriopentane-1,2,3,5-tetrol (PubChem CID 54540788) has the molecular formula C5H12O4 and a molecular weight of 137.15 g/mol. Its IUPAC name is (2R,3S,4S)-4-deuteriopentane-1,2,3,5-tetrol.
| Compound Name | (2R,3S,4S)-4-deuteriopentane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 54540788 |
| Molecular Formula | C5H12O4 |
| Molecular Weight | 137.15 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (2R,3S,4S)-4-deuteriopentane-1,2,3,5-tetrol |
| SMILES | [2H][C@@H](CO)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H12O4/c6-2-1-4(8)5(9)3-7/h4-9H,1-3H2/t4-,5+/m0/s1/i1D/t1-,4-,5+ |
| InChIKey | ZDAWZDFBPUUDAY-ZHLDJJIDSA-N |
| XLogP | -1.92 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.15 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |