C16H34O4 — CID 100981820
(3S,4S)-1,1,1,2,2-pentadeuterio-14-(methoxymethoxy)tetradecane-3,4-diol (PubChem CID 100981820) has the molecular formula C16H34O4 and a molecular weight of 295.47 g/mol. Its IUPAC name is (3S,4S)-1,1,1,2,2-pentadeuterio-14-(methoxymethoxy)tetradecane-3,4-diol.
| Compound Name | (3S,4S)-1,1,1,2,2-pentadeuterio-14-(methoxymethoxy)tetradecane-3,4-diol |
|---|---|
| PubChem CID | 100981820 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.28 |
| IUPAC Name | (3S,4S)-1,1,1,2,2-pentadeuterio-14-(methoxymethoxy)tetradecane-3,4-diol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])[C@H](O)[C@@H](O)CCCCCCCCCCOCOC |
| InChI | InChI=1S/C16H34O4/c1-3-15(17)16(18)12-10-8-6-4-5-7-9-11-13-20-14-19-2/h15-18H,3-14H2,1-2H3/t15-,16-/m0/s1/i1D3,3D2 |
| InChIKey | VGTPYFUVLBRGEU-GUGKAFEZSA-N |
| XLogP | 3.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|