C12H20F2S2 — CID 102156320
2-(3,3-difluoroprop-2-enyl)-2-pentyl-1,3-dithiane (PubChem CID 102156320) has the molecular formula C12H20F2S2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2-(3,3-difluoroprop-2-enyl)-2-pentyl-1,3-dithiane.
| Compound Name | 2-(3,3-difluoroprop-2-enyl)-2-pentyl-1,3-dithiane |
|---|---|
| PubChem CID | 102156320 |
| Molecular Formula | C12H20F2S2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-(3,3-difluoroprop-2-enyl)-2-pentyl-1,3-dithiane |
| SMILES | CCCCCC1(CC=C(F)F)SCCCS1 |
| InChI | InChI=1S/C12H20F2S2/c1-2-3-4-7-12(8-6-11(13)14)15-9-5-10-16-12/h6H,2-5,7-10H2,1H3 |
| InChIKey | SQYGWPSHSJFUIQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|