C17H26S2Si — CID 135078488
dimethyl-[2-(2-phenylethyl)-1,3-dithian-2-yl]-prop-2-enylsilane (PubChem CID 135078488) has the molecular formula C17H26S2Si and a molecular weight of 322.62 g/mol. Its IUPAC name is dimethyl-[2-(2-phenylethyl)-1,3-dithian-2-yl]-prop-2-enylsilane.
| Compound Name | dimethyl-[2-(2-phenylethyl)-1,3-dithian-2-yl]-prop-2-enylsilane |
|---|---|
| PubChem CID | 135078488 |
| Molecular Formula | C17H26S2Si |
| Molecular Weight | 322.62 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | dimethyl-[2-(2-phenylethyl)-1,3-dithian-2-yl]-prop-2-enylsilane |
| SMILES | C=CC[Si](C)(C)C1(CCc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C17H26S2Si/c1-4-15-20(2,3)17(18-13-8-14-19-17)12-11-16-9-6-5-7-10-16/h4-7,9-10H,1,8,11-15H2,2-3H3 |
| InChIKey | OOHAFETWNQKZCR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|