C20H41NaO12P4S — CID 177390146
sodium (3S)-2,3,4,5-tetrakis(diethoxyphosphoryl)-3H-thiophen-2-ide (PubChem CID 177390146) has the molecular formula C20H41NaO12P4S and a molecular weight of 652.49 g/mol. Its IUPAC name is sodium (3S)-2,3,4,5-tetrakis(diethoxyphosphoryl)-3H-thiophen-2-ide.
| Compound Name | sodium (3S)-2,3,4,5-tetrakis(diethoxyphosphoryl)-3H-thiophen-2-ide |
|---|---|
| PubChem CID | 177390146 |
| Molecular Formula | C20H41NaO12P4S |
| Molecular Weight | 652.49 g/mol |
| Exact Mass | 652.12 |
| IUPAC Name | sodium (3S)-2,3,4,5-tetrakis(diethoxyphosphoryl)-3H-thiophen-2-ide |
| SMILES | CCOP(=O)(OCC)C1=C(P(=O)(OCC)OCC)[C@H](P(=O)(OCC)OCC)[C-](P(=O)(OCC)OCC)S1.[Na+] |
| InChI | InChI=1S/C20H41O12P4S.Na/c1-9-25-33(21,26-10-2)17-18(34(22,27-11-3)28-12-4)20(36(24,31-15-7)32-16-8)37-19(17)35(23,29-13-5)30-14-6;/h17H,9-16H2,1-8H3;/q-1;+1/t17-;/m0./s1 |
| InChIKey | DYGPNJREUVPMKV-LMOVPXPDSA-N |
| XLogP | 4.83 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|