C15H26N2O6P2 — CID 102008496
4,6-bis(diethoxyphosphoryl)-1-methyl-4H-pyridine-3-carbonitrile (PubChem CID 102008496) has the molecular formula C15H26N2O6P2 and a molecular weight of 392.33 g/mol. Its IUPAC name is 4,6-bis(diethoxyphosphoryl)-1-methyl-4H-pyridine-3-carbonitrile.
| Compound Name | 4,6-bis(diethoxyphosphoryl)-1-methyl-4H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102008496 |
| Molecular Formula | C15H26N2O6P2 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 4,6-bis(diethoxyphosphoryl)-1-methyl-4H-pyridine-3-carbonitrile |
| SMILES | CCOP(=O)(OCC)C1=CC(P(=O)(OCC)OCC)C(C#N)=CN1C |
| InChI | InChI=1S/C15H26N2O6P2/c1-6-20-24(18,21-7-2)14-10-15(17(5)12-13(14)11-16)25(19,22-8-3)23-9-4/h10,12,14H,6-9H2,1-5H3 |
| InChIKey | IFLFDUKYWOBMAY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 98.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|