C13H15F2N4O3P — CID 122365505
2,4-diamino-5-diethoxyphosphoryl-6-(difluoromethyl)benzene-1,3-dicarbonitrile (PubChem CID 122365505) has the molecular formula C13H15F2N4O3P and a molecular weight of 344.26 g/mol. Its IUPAC name is 2,4-diamino-5-diethoxyphosphoryl-6-(difluoromethyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2,4-diamino-5-diethoxyphosphoryl-6-(difluoromethyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 122365505 |
| Molecular Formula | C13H15F2N4O3P |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2,4-diamino-5-diethoxyphosphoryl-6-(difluoromethyl)benzene-1,3-dicarbonitrile |
| SMILES | CCOP(=O)(OCC)c1c(N)c(C#N)c(N)c(C#N)c1C(F)F |
| InChI | InChI=1S/C13H15F2N4O3P/c1-3-21-23(20,22-4-2)12-9(13(14)15)7(5-16)10(18)8(6-17)11(12)19/h13H,3-4,18-19H2,1-2H3 |
| InChIKey | FIDUEZXKEMSFJJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|