C16H22O6P2S — CID 102355246
3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene (PubChem CID 102355246) has the molecular formula C16H22O6P2S and a molecular weight of 404.36 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene.
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene |
|---|---|
| PubChem CID | 102355246 |
| Molecular Formula | C16H22O6P2S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene |
| SMILES | C#Cc1sc(C#C)c(P(=O)(OCC)OCC)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H22O6P2S/c1-7-13-15(23(17,19-9-3)20-10-4)16(14(8-2)25-13)24(18,21-11-5)22-12-6/h1-2H,9-12H2,3-6H3 |
| InChIKey | IDFPMWFLBYAFDH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|