About 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene
3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene (PubChem CID 102355246) has the molecular formula C16H22O6P2S
and a molecular weight of 404.36 g/mol. Its IUPAC name is 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene.
Molecular Properties
| Compound Name | 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene |
| PubChem CID | 102355246 |
| Molecular Formula | C16H22O6P2S |
| Molecular Weight | 404.36 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene |
| SMILES | C#Cc1sc(C#C)c(P(=O)(OCC)OCC)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C16H22O6P2S/c1-7-13-15(23(17,19-9-3)20-10-4)16(14(8-2)25-13)24(18,21-11-5)22-12-6/h1-2H,9-12H2,3-6H3 |
| InChIKey | IDFPMWFLBYAFDH-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene?
The IUPAC name of 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene (CID 102355246) is 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene.
What is the SMILES notation for 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene?
The canonical SMILES for 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene is C#Cc1sc(C#C)c(P(=O)(OCC)OCC)c1P(=O)(OCC)OCC.
What is the InChIKey of 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene?
The InChIKey is IDFPMWFLBYAFDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O6P2S/c1-7-13-15(23(17,19-9-3)20-10-4)16(14(8-2)25-13)24(18,21-11-5)22-12-6/h1-2H,9-12H2,3-6H3.
What are the key properties of 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene?
3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene has a molecular weight of 404.36 g/mol, XLogP of 3.49, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(diethoxyphosphoryl)-2,5-diethynylthiophene is sourced from PubChem (CID 102355246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).