C10H12BrF2O3P — CID 166609875
1-bromo-2-diethoxyphosphoryl-3,5-difluorobenzene (PubChem CID 166609875) has the molecular formula C10H12BrF2O3P and a molecular weight of 329.08 g/mol. Its IUPAC name is 1-bromo-2-diethoxyphosphoryl-3,5-difluorobenzene.
| Compound Name | 1-bromo-2-diethoxyphosphoryl-3,5-difluorobenzene |
|---|---|
| PubChem CID | 166609875 |
| Molecular Formula | C10H12BrF2O3P |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 1-bromo-2-diethoxyphosphoryl-3,5-difluorobenzene |
| SMILES | CCOP(=O)(OCC)c1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C10H12BrF2O3P/c1-3-15-17(14,16-4-2)10-8(11)5-7(12)6-9(10)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | IKJHQJCRRNUEEJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|