C11H15F3NO3P — CID 171191781
(S)-diethoxyphosphoryl-(2,3,5-trifluorophenyl)methanamine (PubChem CID 171191781) has the molecular formula C11H15F3NO3P and a molecular weight of 297.21 g/mol. Its IUPAC name is (S)-diethoxyphosphoryl-(2,3,5-trifluorophenyl)methanamine.
| Compound Name | (S)-diethoxyphosphoryl-(2,3,5-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 171191781 |
| Molecular Formula | C11H15F3NO3P |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (S)-diethoxyphosphoryl-(2,3,5-trifluorophenyl)methanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cc(F)cc(F)c1F |
| InChI | InChI=1S/C11H15F3NO3P/c1-3-17-19(16,18-4-2)11(15)8-5-7(12)6-9(13)10(8)14/h5-6,11H,3-4,15H2,1-2H3/t11-/m0/s1 |
| InChIKey | CZOGYGZIBDQDBF-NSHDSACASA-N |
| XLogP | 3.33 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|