C11H17FNO4P — CID 171192048
4-[(R)-amino(diethoxyphosphoryl)methyl]-2-fluorophenol (PubChem CID 171192048) has the molecular formula C11H17FNO4P and a molecular weight of 277.23 g/mol. Its IUPAC name is 4-[(R)-amino(diethoxyphosphoryl)methyl]-2-fluorophenol.
| Compound Name | 4-[(R)-amino(diethoxyphosphoryl)methyl]-2-fluorophenol |
|---|---|
| PubChem CID | 171192048 |
| Molecular Formula | C11H17FNO4P |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-[(R)-amino(diethoxyphosphoryl)methyl]-2-fluorophenol |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C11H17FNO4P/c1-3-16-18(15,17-4-2)11(13)8-5-6-10(14)9(12)7-8/h5-7,11,14H,3-4,13H2,1-2H3/t11-/m1/s1 |
| InChIKey | LLKSLFGJYJWLOK-LLVKDONJSA-N |
| XLogP | 2.75 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|