C11H16F2NO3P — CID 171191753
(S)-diethoxyphosphoryl-(2,3-difluorophenyl)methanamine (PubChem CID 171191753) has the molecular formula C11H16F2NO3P and a molecular weight of 279.22 g/mol. Its IUPAC name is (S)-diethoxyphosphoryl-(2,3-difluorophenyl)methanamine.
| Compound Name | (S)-diethoxyphosphoryl-(2,3-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 171191753 |
| Molecular Formula | C11H16F2NO3P |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | (S)-diethoxyphosphoryl-(2,3-difluorophenyl)methanamine |
| SMILES | CCOP(=O)(OCC)[C@H](N)c1cccc(F)c1F |
| InChI | InChI=1S/C11H16F2NO3P/c1-3-16-18(15,17-4-2)11(14)8-6-5-7-9(12)10(8)13/h5-7,11H,3-4,14H2,1-2H3/t11-/m0/s1 |
| InChIKey | UPTIOXRZYZKYFN-NSHDSACASA-N |
| XLogP | 3.19 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|