C12H19FNO4P — CID 171192202
2-[(R)-amino(diethoxyphosphoryl)methyl]-4-fluoro-6-methylphenol (PubChem CID 171192202) has the molecular formula C12H19FNO4P and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[(R)-amino(diethoxyphosphoryl)methyl]-4-fluoro-6-methylphenol.
| Compound Name | 2-[(R)-amino(diethoxyphosphoryl)methyl]-4-fluoro-6-methylphenol |
|---|---|
| PubChem CID | 171192202 |
| Molecular Formula | C12H19FNO4P |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[(R)-amino(diethoxyphosphoryl)methyl]-4-fluoro-6-methylphenol |
| SMILES | CCOP(=O)(OCC)[C@@H](N)c1cc(F)cc(C)c1O |
| InChI | InChI=1S/C12H19FNO4P/c1-4-17-19(16,18-5-2)12(14)10-7-9(13)6-8(3)11(10)15/h6-7,12,15H,4-5,14H2,1-3H3/t12-/m1/s1 |
| InChIKey | FUTDALSPABPNKU-GFCCVEGCSA-N |
| XLogP | 3.06 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|