C8H7Br2F — CID 118830275
1,2-dibromo-3-ethyl-5-fluorobenzene (PubChem CID 118830275) has the molecular formula C8H7Br2F and a molecular weight of 281.95 g/mol. Its IUPAC name is 1,2-dibromo-3-ethyl-5-fluorobenzene.
| Compound Name | 1,2-dibromo-3-ethyl-5-fluorobenzene |
|---|---|
| PubChem CID | 118830275 |
| Molecular Formula | C8H7Br2F |
| Molecular Weight | 281.95 g/mol |
| Exact Mass | 279.89 |
| IUPAC Name | 1,2-dibromo-3-ethyl-5-fluorobenzene |
| SMILES | CCc1cc(F)cc(Br)c1Br |
| InChI | InChI=1S/C8H7Br2F/c1-2-5-3-6(11)4-7(9)8(5)10/h3-4H,2H2,1H3 |
| InChIKey | SYYSFEKHVMNDIZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.95 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|