C36H74O6P2SSn2 — CID 86638412
[3,4-bis(diethoxyphosphoryl)-5-tributylstannylthiophen-2-yl]-tributylstannane (PubChem CID 86638412) has the molecular formula C36H74O6P2SSn2 and a molecular weight of 934.42 g/mol. Its IUPAC name is [3,4-bis(diethoxyphosphoryl)-5-tributylstannylthiophen-2-yl]-tributylstannane.
| Compound Name | [3,4-bis(diethoxyphosphoryl)-5-tributylstannylthiophen-2-yl]-tributylstannane |
|---|---|
| PubChem CID | 86638412 |
| Molecular Formula | C36H74O6P2SSn2 |
| Molecular Weight | 934.42 g/mol |
| Exact Mass | 936.27 |
| IUPAC Name | [3,4-bis(diethoxyphosphoryl)-5-tributylstannylthiophen-2-yl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1sc([Sn](CCCC)(CCCC)CCCC)c(P(=O)(OCC)OCC)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C12H20O6P2S.6C4H9.2Sn/c1-5-15-19(13,16-6-2)11-9-21-10-12(11)20(14,17-7-3)18-8-4;6*1-3-4-2;;/h5-8H2,1-4H3;6*1,3-4H2,2H3;; |
| InChIKey | XTCFTTBVKMJZID-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.42 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|