C24H42O12P4S2 — CID 86638409
2-[3,4-bis(diethoxyphosphoryl)thiophen-2-yl]-3,4-bis(diethoxyphosphoryl)thiophene (PubChem CID 86638409) has the molecular formula C24H42O12P4S2 and a molecular weight of 710.62 g/mol. Its IUPAC name is 2-[3,4-bis(diethoxyphosphoryl)thiophen-2-yl]-3,4-bis(diethoxyphosphoryl)thiophene.
| Compound Name | 2-[3,4-bis(diethoxyphosphoryl)thiophen-2-yl]-3,4-bis(diethoxyphosphoryl)thiophene |
|---|---|
| PubChem CID | 86638409 |
| Molecular Formula | C24H42O12P4S2 |
| Molecular Weight | 710.62 g/mol |
| Exact Mass | 710.11 |
| IUPAC Name | 2-[3,4-bis(diethoxyphosphoryl)thiophen-2-yl]-3,4-bis(diethoxyphosphoryl)thiophene |
| SMILES | CCOP(=O)(OCC)c1csc(-c2scc(P(=O)(OCC)OCC)c2P(=O)(OCC)OCC)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H42O12P4S2/c1-9-29-37(25,30-10-2)19-17-41-23(21(19)39(27,33-13-5)34-14-6)24-22(40(28,35-15-7)36-16-8)20(18-42-24)38(26,31-11-3)32-12-4/h17-18H,9-16H2,1-8H3 |
| InChIKey | CRKBONAKGBUFIV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.62 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|