C12H13Br2O3PS2 — CID 59155856
5-bromo-2-(5-bromothiophen-2-yl)-3-diethoxyphosphorylthiophene (PubChem CID 59155856) has the molecular formula C12H13Br2O3PS2 and a molecular weight of 460.15 g/mol. Its IUPAC name is 5-bromo-2-(5-bromothiophen-2-yl)-3-diethoxyphosphorylthiophene.
| Compound Name | 5-bromo-2-(5-bromothiophen-2-yl)-3-diethoxyphosphorylthiophene |
|---|---|
| PubChem CID | 59155856 |
| Molecular Formula | C12H13Br2O3PS2 |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 457.84 |
| IUPAC Name | 5-bromo-2-(5-bromothiophen-2-yl)-3-diethoxyphosphorylthiophene |
| SMILES | CCOP(=O)(OCC)c1cc(Br)sc1-c1ccc(Br)s1 |
| InChI | InChI=1S/C12H13Br2O3PS2/c1-3-16-18(15,17-4-2)8-7-11(14)20-12(8)9-5-6-10(13)19-9/h5-7H,3-4H2,1-2H3 |
| InChIKey | NTCWDXZXXSLBBJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|