C18H28O6P2S2 — CID 59155843
3-diethoxyphosphoryl-2-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)-5-methylthiophene (PubChem CID 59155843) has the molecular formula C18H28O6P2S2 and a molecular weight of 466.50 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)-5-methylthiophene.
| Compound Name | 3-diethoxyphosphoryl-2-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)-5-methylthiophene |
|---|---|
| PubChem CID | 59155843 |
| Molecular Formula | C18H28O6P2S2 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | 3-diethoxyphosphoryl-2-(3-diethoxyphosphoryl-5-methylthiophen-2-yl)-5-methylthiophene |
| SMILES | CCOP(=O)(OCC)c1cc(C)sc1-c1sc(C)cc1P(=O)(OCC)OCC |
| InChI | InChI=1S/C18H28O6P2S2/c1-7-21-25(19,22-8-2)15-11-13(5)27-17(15)18-16(12-14(6)28-18)26(20,23-9-3)24-10-4/h11-12H,7-10H2,1-6H3 |
| InChIKey | GYAYPONXOGYFFY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|