C19H33O3P — CID 174759505
1,3-dibutyl-2-diethoxyphosphoryl-5-methylbenzene (PubChem CID 174759505) has the molecular formula C19H33O3P and a molecular weight of 340.44 g/mol. Its IUPAC name is 1,3-dibutyl-2-diethoxyphosphoryl-5-methylbenzene.
| Compound Name | 1,3-dibutyl-2-diethoxyphosphoryl-5-methylbenzene |
|---|---|
| PubChem CID | 174759505 |
| Molecular Formula | C19H33O3P |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1,3-dibutyl-2-diethoxyphosphoryl-5-methylbenzene |
| SMILES | CCCCc1cc(C)cc(CCCC)c1P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H33O3P/c1-6-10-12-17-14-16(5)15-18(13-11-7-2)19(17)23(20,21-8-3)22-9-4/h14-15H,6-13H2,1-5H3 |
| InChIKey | KESOFHAQBFWPNB-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|