About (3-butyl-2-chlorophenyl) diethyl phosphate
(3-butyl-2-chlorophenyl) diethyl phosphate (PubChem CID 70616337) has the molecular formula C14H22ClO4P
and a molecular weight of 320.75 g/mol. Its IUPAC name is (3-butyl-2-chlorophenyl) diethyl phosphate.
Molecular Properties
| Compound Name | (3-butyl-2-chlorophenyl) diethyl phosphate |
| PubChem CID | 70616337 |
| Molecular Formula | C14H22ClO4P |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (3-butyl-2-chlorophenyl) diethyl phosphate |
| SMILES | CCCCc1cccc(OP(=O)(OCC)OCC)c1Cl |
| InChI | InChI=1S/C14H22ClO4P/c1-4-7-9-12-10-8-11-13(14(12)15)19-20(16,17-5-2)18-6-3/h8,10-11H,4-7,9H2,1-3H3 |
| InChIKey | GUCYYWZTHPOSMZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-butyl-2-chlorophenyl) diethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-butyl-2-chlorophenyl) diethyl phosphate?
The IUPAC name of (3-butyl-2-chlorophenyl) diethyl phosphate (CID 70616337) is (3-butyl-2-chlorophenyl) diethyl phosphate.
What is the SMILES notation for (3-butyl-2-chlorophenyl) diethyl phosphate?
The canonical SMILES for (3-butyl-2-chlorophenyl) diethyl phosphate is CCCCc1cccc(OP(=O)(OCC)OCC)c1Cl.
What is the InChIKey of (3-butyl-2-chlorophenyl) diethyl phosphate?
The InChIKey is GUCYYWZTHPOSMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22ClO4P/c1-4-7-9-12-10-8-11-13(14(12)15)19-20(16,17-5-2)18-6-3/h8,10-11H,4-7,9H2,1-3H3.
What are the key properties of (3-butyl-2-chlorophenyl) diethyl phosphate?
(3-butyl-2-chlorophenyl) diethyl phosphate has a molecular weight of 320.75 g/mol, XLogP of 5.24, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-butyl-2-chlorophenyl) diethyl phosphate is sourced from PubChem (CID 70616337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).