C14H21ClO3 — CID 70975521
2-[2-(3-butyl-2-chlorophenoxy)ethoxy]ethanol (PubChem CID 70975521) has the molecular formula C14H21ClO3 and a molecular weight of 272.77 g/mol. Its IUPAC name is 2-[2-(3-butyl-2-chlorophenoxy)ethoxy]ethanol.
| Compound Name | 2-[2-(3-butyl-2-chlorophenoxy)ethoxy]ethanol |
|---|---|
| PubChem CID | 70975521 |
| Molecular Formula | C14H21ClO3 |
| Molecular Weight | 272.77 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[2-(3-butyl-2-chlorophenoxy)ethoxy]ethanol |
| SMILES | CCCCc1cccc(OCCOCCO)c1Cl |
| InChI | InChI=1S/C14H21ClO3/c1-2-3-5-12-6-4-7-13(14(12)15)18-11-10-17-9-8-16/h4,6-7,16H,2-3,5,8-11H2,1H3 |
| InChIKey | KYCPUFPGVOGLHE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|