About 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol
1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol (PubChem CID 22382209) has the molecular formula C14H23ClO4
and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol.
Molecular Properties
| Compound Name | 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol |
| PubChem CID | 22382209 |
| Molecular Formula | C14H23ClO4 |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol |
| SMILES | CCCCOc1ccccc1Cl.OCCOCCO |
| InChI | InChI=1S/C10H13ClO.C4H10O3/c1-2-3-8-12-10-7-5-4-6-9(10)11;5-1-3-7-4-2-6/h4-7H,2-3,8H2,1H3;5-6H,1-4H2 |
| InChIKey | TVDHBGHOZJHRRC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol?
The IUPAC name of 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol (CID 22382209) is 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol.
What is the SMILES notation for 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol?
The canonical SMILES for 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol is CCCCOc1ccccc1Cl.OCCOCCO.
What is the InChIKey of 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol?
The InChIKey is TVDHBGHOZJHRRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClO.C4H10O3/c1-2-3-8-12-10-7-5-4-6-9(10)11;5-1-3-7-4-2-6/h4-7H,2-3,8H2,1H3;5-6H,1-4H2.
What are the key properties of 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol?
1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol has a molecular weight of 290.79 g/mol, XLogP of 2.51, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butoxy-2-chlorobenzene;2-(2-hydroxyethoxy)ethanol is sourced from PubChem (CID 22382209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).