C15H25AlO — CID 175492073
(2,6-dibutyl-4-methylphenoxy)alumane (PubChem CID 175492073) has the molecular formula C15H25AlO and a molecular weight of 248.35 g/mol. Its IUPAC name is (2,6-dibutyl-4-methylphenoxy)alumane.
| Compound Name | (2,6-dibutyl-4-methylphenoxy)alumane |
|---|---|
| PubChem CID | 175492073 |
| Molecular Formula | C15H25AlO |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | (2,6-dibutyl-4-methylphenoxy)alumane |
| SMILES | CCCCc1cc(C)cc(CCCC)c1O[AlH2] |
| InChI | InChI=1S/C15H24O.Al.2H/c1-4-6-8-13-10-12(3)11-14(15(13)16)9-7-5-2;;;/h10-11,16H,4-9H2,1-3H3;;;/q;+1;;/p-1 |
| InChIKey | OZNWLGRFHLJVQK-UHFFFAOYSA-M |
| XLogP | 3.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |