C20H35O3P — CID 87672568
1,2-dibutyl-3-dipropoxyphosphorylbenzene (PubChem CID 87672568) has the molecular formula C20H35O3P and a molecular weight of 354.47 g/mol. Its IUPAC name is 1,2-dibutyl-3-dipropoxyphosphorylbenzene.
| Compound Name | 1,2-dibutyl-3-dipropoxyphosphorylbenzene |
|---|---|
| PubChem CID | 87672568 |
| Molecular Formula | C20H35O3P |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1,2-dibutyl-3-dipropoxyphosphorylbenzene |
| SMILES | CCCCc1cccc(P(=O)(OCCC)OCCC)c1CCCC |
| InChI | InChI=1S/C20H35O3P/c1-5-9-12-18-13-11-15-20(19(18)14-10-6-2)24(21,22-16-7-3)23-17-8-4/h11,13,15H,5-10,12,14,16-17H2,1-4H3 |
| InChIKey | IFNKBPHEQUPIPF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|