C17H29OP — CID 69050781
(2,3-dibutylphenyl)-propoxyphosphane (PubChem CID 69050781) has the molecular formula C17H29OP and a molecular weight of 280.39 g/mol. Its IUPAC name is (2,3-dibutylphenyl)-propoxyphosphane.
| Compound Name | (2,3-dibutylphenyl)-propoxyphosphane |
|---|---|
| PubChem CID | 69050781 |
| Molecular Formula | C17H29OP |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (2,3-dibutylphenyl)-propoxyphosphane |
| SMILES | CCCCc1cccc(POCCC)c1CCCC |
| InChI | InChI=1S/C17H29OP/c1-4-7-10-15-11-9-13-17(19-18-14-6-3)16(15)12-8-5-2/h9,11,13,19H,4-8,10,12,14H2,1-3H3 |
| InChIKey | VSWOCGLQJPGFJW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|