About CID 173004407
CID 173004407 (PubChem CID 173004407) has the molecular formula C14H21OSn
and a molecular weight of 324.03 g/mol.
Molecular Properties
| Compound Name | CID 173004407 |
| PubChem CID | 173004407 |
| Molecular Formula | C14H21OSn |
| Molecular Weight | 324.03 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | — |
| SMILES | CCCCc1cccc(O[Sn])c1CCCC |
| InChI | InChI=1S/C14H22O.Sn/c1-3-5-8-12-9-7-11-14(15)13(12)10-6-4-2;/h7,9,11,15H,3-6,8,10H2,1-2H3;/q;+1/p-1 |
| InChIKey | WCTZKMYLNITXJS-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.03 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 173004407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173004407?
The IUPAC name of CID 173004407 (CID 173004407) is not available.
What is the SMILES notation for CID 173004407?
The canonical SMILES for CID 173004407 is CCCCc1cccc(O[Sn])c1CCCC.
What is the InChIKey of CID 173004407?
The InChIKey is WCTZKMYLNITXJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H22O.Sn/c1-3-5-8-12-9-7-11-14(15)13(12)10-6-4-2;/h7,9,11,15H,3-6,8,10H2,1-2H3;/q;+1/p-1.
What are the key properties of CID 173004407?
CID 173004407 has a molecular weight of 324.03 g/mol, XLogP of 3.83, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173004407 is sourced from PubChem (CID 173004407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).