C16H27O3P — CID 87674111
butoxy-(2,3-dipropylphenyl)phosphinic acid (PubChem CID 87674111) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is butoxy-(2,3-dipropylphenyl)phosphinic acid.
| Compound Name | butoxy-(2,3-dipropylphenyl)phosphinic acid |
|---|---|
| PubChem CID | 87674111 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | butoxy-(2,3-dipropylphenyl)phosphinic acid |
| SMILES | CCCCOP(=O)(O)c1cccc(CCC)c1CCC |
| InChI | InChI=1S/C16H27O3P/c1-4-7-13-19-20(17,18)16-12-8-11-14(9-5-2)15(16)10-6-3/h8,11-12H,4-7,9-10,13H2,1-3H3,(H,17,18) |
| InChIKey | HVCOVQSNDYPSKC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|