C23H30N2O6P2 — CID 57285241
[5-[4-(4-amino-3-propylanilino)butoxy-hydroxyphosphoryl]naphthalen-1-yl]phosphonic acid (PubChem CID 57285241) has the molecular formula C23H30N2O6P2 and a molecular weight of 492.45 g/mol. Its IUPAC name is [5-[4-(4-amino-3-propylanilino)butoxy-hydroxyphosphoryl]naphthalen-1-yl]phosphonic acid.
| Compound Name | [5-[4-(4-amino-3-propylanilino)butoxy-hydroxyphosphoryl]naphthalen-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 57285241 |
| Molecular Formula | C23H30N2O6P2 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [5-[4-(4-amino-3-propylanilino)butoxy-hydroxyphosphoryl]naphthalen-1-yl]phosphonic acid |
| SMILES | CCCc1cc(NCCCCOP(=O)(O)c2cccc3c(P(=O)(O)O)cccc23)ccc1N |
| InChI | InChI=1S/C23H30N2O6P2/c1-2-7-17-16-18(12-13-21(17)24)25-14-3-4-15-31-33(29,30)23-11-6-8-19-20(23)9-5-10-22(19)32(26,27)28/h5-6,8-13,16,25H,2-4,7,14-15,24H2,1H3,(H,29,30)(H2,26,27,28) |
| InChIKey | BXNKQWQYZDLQOJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|