C13H21O7PS — CID 118860040
3-[2-[butoxy(hydroxy)phosphoryl]phenoxy]propane-1-sulfonic acid (PubChem CID 118860040) has the molecular formula C13H21O7PS and a molecular weight of 352.35 g/mol. Its IUPAC name is 3-[2-[butoxy(hydroxy)phosphoryl]phenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[2-[butoxy(hydroxy)phosphoryl]phenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 118860040 |
| Molecular Formula | C13H21O7PS |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[2-[butoxy(hydroxy)phosphoryl]phenoxy]propane-1-sulfonic acid |
| SMILES | CCCCOP(=O)(O)c1ccccc1OCCCS(=O)(=O)O |
| InChI | InChI=1S/C13H21O7PS/c1-2-3-10-20-21(14,15)13-8-5-4-7-12(13)19-9-6-11-22(16,17)18/h4-5,7-8H,2-3,6,9-11H2,1H3,(H,14,15)(H,16,17,18) |
| InChIKey | UXQJGELEZUKEAY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|