C17H19BF5N2O4PS — CID 15833053
[5-cyano-3-diethoxyphosphoryl-6-(4-fluorophenyl)-4-methylsulfanylpyran-2-ylidene]azanium tetrafluoroborate (PubChem CID 15833053) has the molecular formula C17H19BF5N2O4PS and a molecular weight of 484.19 g/mol. Its IUPAC name is [5-cyano-3-diethoxyphosphoryl-6-(4-fluorophenyl)-4-methylsulfanylpyran-2-ylidene]azanium tetrafluoroborate.
| Compound Name | [5-cyano-3-diethoxyphosphoryl-6-(4-fluorophenyl)-4-methylsulfanylpyran-2-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 15833053 |
| Molecular Formula | C17H19BF5N2O4PS |
| Molecular Weight | 484.19 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | [5-cyano-3-diethoxyphosphoryl-6-(4-fluorophenyl)-4-methylsulfanylpyran-2-ylidene]azanium tetrafluoroborate |
| SMILES | CCOP(=O)(OCC)c1c(SC)c(C#N)c(-c2ccc(F)cc2)oc1=[NH2+].F[B-](F)(F)F |
| InChI | InChI=1S/C17H18FN2O4PS.BF4/c1-4-22-25(21,23-5-2)15-16(26-3)13(10-19)14(24-17(15)20)11-6-8-12(18)9-7-11;2-1(3,4)5/h6-9,20H,4-5H2,1-3H3;/q;-1/p+1 |
| InChIKey | UGQAYGRJKFQLGL-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.19 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|