C16H18N3O4PS — CID 168588734
4-(4-diethoxyphosphorylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588734) has the molecular formula C16H18N3O4PS and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-(4-diethoxyphosphorylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-(4-diethoxyphosphorylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588734 |
| Molecular Formula | C16H18N3O4PS |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 4-(4-diethoxyphosphorylphenyl)-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CCOP(=O)(OCC)c1ccc(-c2nc(SC)[nH]c(=O)c2C#N)cc1 |
| InChI | InChI=1S/C16H18N3O4PS/c1-4-22-24(21,23-5-2)12-8-6-11(7-9-12)14-13(10-17)15(20)19-16(18-14)25-3/h6-9H,4-5H2,1-3H3,(H,18,19,20) |
| InChIKey | CMSGVNYJAAWJCE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|