C21H20BF4N2O2PS — CID 134910882
[5-cyano-3-[ethyl(phenyl)phosphoryl]-4-methylsulfanyl-6-phenylpyran-2-ylidene]azanium tetrafluoroborate (PubChem CID 134910882) has the molecular formula C21H20BF4N2O2PS and a molecular weight of 482.25 g/mol. Its IUPAC name is [5-cyano-3-[ethyl(phenyl)phosphoryl]-4-methylsulfanyl-6-phenylpyran-2-ylidene]azanium tetrafluoroborate.
| Compound Name | [5-cyano-3-[ethyl(phenyl)phosphoryl]-4-methylsulfanyl-6-phenylpyran-2-ylidene]azanium tetrafluoroborate |
|---|---|
| PubChem CID | 134910882 |
| Molecular Formula | C21H20BF4N2O2PS |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | [5-cyano-3-[ethyl(phenyl)phosphoryl]-4-methylsulfanyl-6-phenylpyran-2-ylidene]azanium tetrafluoroborate |
| SMILES | CCP(=O)(c1ccccc1)c1c(SC)c(C#N)c(-c2ccccc2)oc1=[NH2+].F[B-](F)(F)F |
| InChI | InChI=1S/C21H19N2O2PS.BF4/c1-3-26(24,16-12-8-5-9-13-16)19-20(27-2)17(14-22)18(25-21(19)23)15-10-6-4-7-11-15;2-1(3,4)5/h4-13,23H,3H2,1-2H3;/q;-1/p+1 |
| InChIKey | RPANBEQUSXWMSC-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 79.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|