C18H15BrOS — CID 102102119
3-(bromomethyl)-4-methylsulfanyl-2,5-diphenylfuran (PubChem CID 102102119) has the molecular formula C18H15BrOS and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-(bromomethyl)-4-methylsulfanyl-2,5-diphenylfuran.
| Compound Name | 3-(bromomethyl)-4-methylsulfanyl-2,5-diphenylfuran |
|---|---|
| PubChem CID | 102102119 |
| Molecular Formula | C18H15BrOS |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 3-(bromomethyl)-4-methylsulfanyl-2,5-diphenylfuran |
| SMILES | CSc1c(-c2ccccc2)oc(-c2ccccc2)c1CBr |
| InChI | InChI=1S/C18H15BrOS/c1-21-18-15(12-19)16(13-8-4-2-5-9-13)20-17(18)14-10-6-3-7-11-14/h2-11H,12H2,1H3 |
| InChIKey | NAFOFWOFJHANBX-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|