C19H20FN2O3P — CID 21179121
4-[ethoxy(phenyl)phosphoryl]-2-(4-fluorophenyl)-N,N-dimethyl-1,3-oxazol-5-amine (PubChem CID 21179121) has the molecular formula C19H20FN2O3P and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-[ethoxy(phenyl)phosphoryl]-2-(4-fluorophenyl)-N,N-dimethyl-1,3-oxazol-5-amine.
| Compound Name | 4-[ethoxy(phenyl)phosphoryl]-2-(4-fluorophenyl)-N,N-dimethyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 21179121 |
| Molecular Formula | C19H20FN2O3P |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-[ethoxy(phenyl)phosphoryl]-2-(4-fluorophenyl)-N,N-dimethyl-1,3-oxazol-5-amine |
| SMILES | CCOP(=O)(c1ccccc1)c1nc(-c2ccc(F)cc2)oc1N(C)C |
| InChI | InChI=1S/C19H20FN2O3P/c1-4-24-26(23,16-8-6-5-7-9-16)18-19(22(2)3)25-17(21-18)14-10-12-15(20)13-11-14/h5-13H,4H2,1-3H3 |
| InChIKey | JHUMKOHZVHFQFX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|