C22H18NO2P — CID 11078866
4-diphenylphosphoryl-5-methyl-2-phenyl-1,3-oxazole (PubChem CID 11078866) has the molecular formula C22H18NO2P and a molecular weight of 359.37 g/mol. Its IUPAC name is 4-diphenylphosphoryl-5-methyl-2-phenyl-1,3-oxazole.
| Compound Name | 4-diphenylphosphoryl-5-methyl-2-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 11078866 |
| Molecular Formula | C22H18NO2P |
| Molecular Weight | 359.37 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-diphenylphosphoryl-5-methyl-2-phenyl-1,3-oxazole |
| SMILES | Cc1oc(-c2ccccc2)nc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18NO2P/c1-17-22(23-21(25-17)18-11-5-2-6-12-18)26(24,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16H,1H3 |
| InChIKey | POUXBBAKMBSXBX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|