C21H23N2O2P — CID 21179106
4-diphenylphosphoryl-2-methyl-5-piperidin-1-yl-1,3-oxazole (PubChem CID 21179106) has the molecular formula C21H23N2O2P and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-diphenylphosphoryl-2-methyl-5-piperidin-1-yl-1,3-oxazole.
| Compound Name | 4-diphenylphosphoryl-2-methyl-5-piperidin-1-yl-1,3-oxazole |
|---|---|
| PubChem CID | 21179106 |
| Molecular Formula | C21H23N2O2P |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 4-diphenylphosphoryl-2-methyl-5-piperidin-1-yl-1,3-oxazole |
| SMILES | Cc1nc(P(=O)(c2ccccc2)c2ccccc2)c(N2CCCCC2)o1 |
| InChI | InChI=1S/C21H23N2O2P/c1-17-22-20(21(25-17)23-15-9-4-10-16-23)26(24,18-11-5-2-6-12-18)19-13-7-3-8-14-19/h2-3,5-8,11-14H,4,9-10,15-16H2,1H3 |
| InChIKey | DRDKZPWBRVACIT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|