C18H18NO2P — CID 101350621
4-diphenylphosphoryl-5-ethyl-2-methyl-1,3-oxazole (PubChem CID 101350621) has the molecular formula C18H18NO2P and a molecular weight of 311.32 g/mol. Its IUPAC name is 4-diphenylphosphoryl-5-ethyl-2-methyl-1,3-oxazole.
| Compound Name | 4-diphenylphosphoryl-5-ethyl-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 101350621 |
| Molecular Formula | C18H18NO2P |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 4-diphenylphosphoryl-5-ethyl-2-methyl-1,3-oxazole |
| SMILES | CCc1oc(C)nc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H18NO2P/c1-3-17-18(19-14(2)21-17)22(20,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,3H2,1-2H3 |
| InChIKey | ZZFNPFVIRQOPPM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|