C17H17N2O2P — CID 21179104
4-diphenylphosphoryl-N,2-dimethyl-1,3-oxazol-5-amine (PubChem CID 21179104) has the molecular formula C17H17N2O2P and a molecular weight of 312.31 g/mol. Its IUPAC name is 4-diphenylphosphoryl-N,2-dimethyl-1,3-oxazol-5-amine.
| Compound Name | 4-diphenylphosphoryl-N,2-dimethyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 21179104 |
| Molecular Formula | C17H17N2O2P |
| Molecular Weight | 312.31 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-diphenylphosphoryl-N,2-dimethyl-1,3-oxazol-5-amine |
| SMILES | CNc1oc(C)nc1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H17N2O2P/c1-13-19-17(16(18-2)21-13)22(20,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,18H,1-2H3 |
| InChIKey | QWCARVOQNTXLKT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|