C46H34N2O4P2 — CID 122207844
4,8-bis(4-diphenylphosphorylphenyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole (PubChem CID 122207844) has the molecular formula C46H34N2O4P2 and a molecular weight of 740.74 g/mol. Its IUPAC name is 4,8-bis(4-diphenylphosphorylphenyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole.
| Compound Name | 4,8-bis(4-diphenylphosphorylphenyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
|---|---|
| PubChem CID | 122207844 |
| Molecular Formula | C46H34N2O4P2 |
| Molecular Weight | 740.74 g/mol |
| Exact Mass | 740.20 |
| IUPAC Name | 4,8-bis(4-diphenylphosphorylphenyl)-2,6-dimethyl-[1,3]oxazolo[5,4-f][1,3]benzoxazole |
| SMILES | Cc1nc2c(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)c3oc(C)nc3c(-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)c2o1 |
| InChI | InChI=1S/C46H34N2O4P2/c1-31-47-43-41(33-23-27-39(28-24-33)53(49,35-15-7-3-8-16-35)36-17-9-4-10-18-36)46-44(48-32(2)52-46)42(45(43)51-31)34-25-29-40(30-26-34)54(50,37-19-11-5-12-20-37)38-21-13-6-14-22-38/h3-30H,1-2H3 |
| InChIKey | SXZINUFSZYRPOD-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 86.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.74 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|