C18H19N2O2P — CID 21179105
4-diphenylphosphoryl-N,N,2-trimethyl-1,3-oxazol-5-amine (PubChem CID 21179105) has the molecular formula C18H19N2O2P and a molecular weight of 326.34 g/mol. Its IUPAC name is 4-diphenylphosphoryl-N,N,2-trimethyl-1,3-oxazol-5-amine.
| Compound Name | 4-diphenylphosphoryl-N,N,2-trimethyl-1,3-oxazol-5-amine |
|---|---|
| PubChem CID | 21179105 |
| Molecular Formula | C18H19N2O2P |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-diphenylphosphoryl-N,N,2-trimethyl-1,3-oxazol-5-amine |
| SMILES | Cc1nc(P(=O)(c2ccccc2)c2ccccc2)c(N(C)C)o1 |
| InChI | InChI=1S/C18H19N2O2P/c1-14-19-17(18(22-14)20(2)3)23(21,15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13H,1-3H3 |
| InChIKey | IIRJEOWGSSEGDL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|