C29H25NO3P2 — CID 139170088
2,6-bis(diphenylphosphoryl)pyridine;hydrate (PubChem CID 139170088) has the molecular formula C29H25NO3P2 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2,6-bis(diphenylphosphoryl)pyridine;hydrate.
| Compound Name | 2,6-bis(diphenylphosphoryl)pyridine;hydrate |
|---|---|
| PubChem CID | 139170088 |
| Molecular Formula | C29H25NO3P2 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 2,6-bis(diphenylphosphoryl)pyridine;hydrate |
| SMILES | O.O=P(c1ccccc1)(c1ccccc1)c1cccc(P(=O)(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C29H23NO2P2.H2O/c31-33(24-14-5-1-6-15-24,25-16-7-2-8-17-25)28-22-13-23-29(30-28)34(32,26-18-9-3-10-19-26)27-20-11-4-12-21-27;/h1-23H;1H2 |
| InChIKey | GFAOJTPUAFJWQE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|