C17H18N2O — CID 13466195
2-methyl-4-piperidin-1-ylfuro[2,3-c]quinoline (PubChem CID 13466195) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-methyl-4-piperidin-1-ylfuro[2,3-c]quinoline.
| Compound Name | 2-methyl-4-piperidin-1-ylfuro[2,3-c]quinoline |
|---|---|
| PubChem CID | 13466195 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-methyl-4-piperidin-1-ylfuro[2,3-c]quinoline |
| SMILES | Cc1cc2c(o1)c(N1CCCCC1)nc1ccccc12 |
| InChI | InChI=1S/C17H18N2O/c1-12-11-14-13-7-3-4-8-15(13)18-17(16(14)20-12)19-9-5-2-6-10-19/h3-4,7-8,11H,2,5-6,9-10H2,1H3 |
| InChIKey | PNQNSHBEULIOKX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |