C17H21BrN2 — CID 107079697
2-(azocan-1-yl)-3-(bromomethyl)quinoline (PubChem CID 107079697) has the molecular formula C17H21BrN2 and a molecular weight of 333.27 g/mol. Its IUPAC name is 2-(azocan-1-yl)-3-(bromomethyl)quinoline.
| Compound Name | 2-(azocan-1-yl)-3-(bromomethyl)quinoline |
|---|---|
| PubChem CID | 107079697 |
| Molecular Formula | C17H21BrN2 |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-(azocan-1-yl)-3-(bromomethyl)quinoline |
| SMILES | BrCc1cc2ccccc2nc1N1CCCCCCC1 |
| InChI | InChI=1S/C17H21BrN2/c18-13-15-12-14-8-4-5-9-16(14)19-17(15)20-10-6-2-1-3-7-11-20/h4-5,8-9,12H,1-3,6-7,10-11,13H2 |
| InChIKey | AUNWQSZEVFSIRT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|