C16H20BrN3 — CID 107083281
1-[3-(bromomethyl)quinolin-2-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 107083281) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-[3-(bromomethyl)quinolin-2-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | 1-[3-(bromomethyl)quinolin-2-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 107083281 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 1-[3-(bromomethyl)quinolin-2-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)C1CCN(c2nc3ccccc3cc2CBr)C1 |
| InChI | InChI=1S/C16H20BrN3/c1-19(2)14-7-8-20(11-14)16-13(10-17)9-12-5-3-4-6-15(12)18-16/h3-6,9,14H,7-8,10-11H2,1-2H3 |
| InChIKey | WGXPYGXQEZOSDE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|