C18H23BrN2 — CID 107085362
3-(bromomethyl)-2-(2,3,5-trimethylpiperidin-1-yl)quinoline (PubChem CID 107085362) has the molecular formula C18H23BrN2 and a molecular weight of 347.30 g/mol. Its IUPAC name is 3-(bromomethyl)-2-(2,3,5-trimethylpiperidin-1-yl)quinoline.
| Compound Name | 3-(bromomethyl)-2-(2,3,5-trimethylpiperidin-1-yl)quinoline |
|---|---|
| PubChem CID | 107085362 |
| Molecular Formula | C18H23BrN2 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-(bromomethyl)-2-(2,3,5-trimethylpiperidin-1-yl)quinoline |
| SMILES | CC1CC(C)C(C)N(c2nc3ccccc3cc2CBr)C1 |
| InChI | InChI=1S/C18H23BrN2/c1-12-8-13(2)14(3)21(11-12)18-16(10-19)9-15-6-4-5-7-17(15)20-18/h4-7,9,12-14H,8,10-11H2,1-3H3 |
| InChIKey | XFOJMRISPQZNAK-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|