C13H19BrN2 — CID 114594537
2-bromo-6-(2,3,5-trimethylpiperidin-1-yl)pyridine (PubChem CID 114594537) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is 2-bromo-6-(2,3,5-trimethylpiperidin-1-yl)pyridine.
| Compound Name | 2-bromo-6-(2,3,5-trimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 114594537 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-bromo-6-(2,3,5-trimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CC(C)C(C)N(c2cccc(Br)n2)C1 |
| InChI | InChI=1S/C13H19BrN2/c1-9-7-10(2)11(3)16(8-9)13-6-4-5-12(14)15-13/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | GNJIQMATJVGUAD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|