C14H21ClN2 — CID 114594776
2-(chloromethyl)-6-(2,3,5-trimethylpiperidin-1-yl)pyridine (PubChem CID 114594776) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 2-(chloromethyl)-6-(2,3,5-trimethylpiperidin-1-yl)pyridine.
| Compound Name | 2-(chloromethyl)-6-(2,3,5-trimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 114594776 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-(chloromethyl)-6-(2,3,5-trimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CC(C)C(C)N(c2cccc(CCl)n2)C1 |
| InChI | InChI=1S/C14H21ClN2/c1-10-7-11(2)12(3)17(9-10)14-6-4-5-13(8-15)16-14/h4-6,10-12H,7-9H2,1-3H3 |
| InChIKey | WFFASWKOYFQTKX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|